C13H12BrN3O3 — CID 108844941
2-[[(Z)-3-(2-bromoanilino)-2-cyanoprop-2-enoyl]amino]propanoic acid (PubChem CID 108844941) has the molecular formula C13H12BrN3O3 and a molecular weight of 338.16 g/mol. Its IUPAC name is 2-[[(Z)-3-(2-bromoanilino)-2-cyanoprop-2-enoyl]amino]propanoic acid.
| Compound Name | 2-[[(Z)-3-(2-bromoanilino)-2-cyanoprop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 108844941 |
| Molecular Formula | C13H12BrN3O3 |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 2-[[(Z)-3-(2-bromoanilino)-2-cyanoprop-2-enoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)/C(C#N)=C\Nc1ccccc1Br)C(=O)O |
| InChI | InChI=1S/C13H12BrN3O3/c1-8(13(19)20)17-12(18)9(6-15)7-16-11-5-3-2-4-10(11)14/h2-5,7-8,16H,1H3,(H,17,18)(H,19,20)/b9-7- |
| InChIKey | NRNHTJUCOSPXFE-CLFYSBASSA-N |
| XLogP | 1.86 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|