C27H33N3O2 — CID 10884517
2a-[4-[4-(2-acetylphenyl)piperazin-1-yl]butyl]-1,3,4,5-tetrahydrobenzo[cd]indol-2-one (PubChem CID 10884517) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is 2a-[4-[4-(2-acetylphenyl)piperazin-1-yl]butyl]-1,3,4,5-tetrahydrobenzo[cd]indol-2-one.
| Compound Name | 2a-[4-[4-(2-acetylphenyl)piperazin-1-yl]butyl]-1,3,4,5-tetrahydrobenzo[cd]indol-2-one |
|---|---|
| PubChem CID | 10884517 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 2a-[4-[4-(2-acetylphenyl)piperazin-1-yl]butyl]-1,3,4,5-tetrahydrobenzo[cd]indol-2-one |
| SMILES | CC(=O)c1ccccc1N1CCN(CCCCC23CCCc4cccc(c42)NC3=O)CC1 |
| InChI | InChI=1S/C27H33N3O2/c1-20(31)22-10-2-3-12-24(22)30-18-16-29(17-19-30)15-5-4-13-27-14-7-9-21-8-6-11-23(25(21)27)28-26(27)32/h2-3,6,8,10-12H,4-5,7,9,13-19H2,1H3,(H,28,32) |
| InChIKey | CEXWBNJTMYHTQB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|