About [2-(acetyloxymethyl)-3-[2-chloro-6-(methylamino)purin-9-yl]propyl] 2-phenylacetate
[2-(acetyloxymethyl)-3-[2-chloro-6-(methylamino)purin-9-yl]propyl] 2-phenylacetate (PubChem CID 10884521) has the molecular formula C20H22ClN5O4
and a molecular weight of 431.88 g/mol. Its IUPAC name is [2-(acetyloxymethyl)-3-[2-chloro-6-(methylamino)purin-9-yl]propyl] 2-phenylacetate.
Molecular Properties
| Compound Name | [2-(acetyloxymethyl)-3-[2-chloro-6-(methylamino)purin-9-yl]propyl] 2-phenylacetate |
| PubChem CID | 10884521 |
| Molecular Formula | C20H22ClN5O4 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | [2-(acetyloxymethyl)-3-[2-chloro-6-(methylamino)purin-9-yl]propyl] 2-phenylacetate |
| SMILES | CNc1nc(Cl)nc2c1ncn2CC(COC(C)=O)COC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C20H22ClN5O4/c1-13(27)29-10-15(11-30-16(28)8-14-6-4-3-5-7-14)9-26-12-23-17-18(22-2)24-20(21)25-19(17)26/h3-7,12,15H,8-11H2,1-2H3,(H,22,24,25) |
| InChIKey | KLANBQIWFUPEHK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze [2-(acetyloxymethyl)-3-[2-chloro-6-(methylamino)purin-9-yl]propyl] 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(acetyloxymethyl)-3-[2-chloro-6-(methylamino)purin-9-yl]propyl] 2-phenylacetate?
The IUPAC name of [2-(acetyloxymethyl)-3-[2-chloro-6-(methylamino)purin-9-yl]propyl] 2-phenylacetate (CID 10884521) is [2-(acetyloxymethyl)-3-[2-chloro-6-(methylamino)purin-9-yl]propyl] 2-phenylacetate.
What is the SMILES notation for [2-(acetyloxymethyl)-3-[2-chloro-6-(methylamino)purin-9-yl]propyl] 2-phenylacetate?
The canonical SMILES for [2-(acetyloxymethyl)-3-[2-chloro-6-(methylamino)purin-9-yl]propyl] 2-phenylacetate is CNc1nc(Cl)nc2c1ncn2CC(COC(C)=O)COC(=O)Cc1ccccc1.
What is the InChIKey of [2-(acetyloxymethyl)-3-[2-chloro-6-(methylamino)purin-9-yl]propyl] 2-phenylacetate?
The InChIKey is KLANBQIWFUPEHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22ClN5O4/c1-13(27)29-10-15(11-30-16(28)8-14-6-4-3-5-7-14)9-26-12-23-17-18(22-2)24-20(21)25-19(17)26/h3-7,12,15H,8-11H2,1-2H3,(H,22,24,25).
What are the key properties of [2-(acetyloxymethyl)-3-[2-chloro-6-(methylamino)purin-9-yl]propyl] 2-phenylacetate?
[2-(acetyloxymethyl)-3-[2-chloro-6-(methylamino)purin-9-yl]propyl] 2-phenylacetate has a molecular weight of 431.88 g/mol, XLogP of 2.49, 9 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(acetyloxymethyl)-3-[2-chloro-6-(methylamino)purin-9-yl]propyl] 2-phenylacetate is sourced from PubChem (CID 10884521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).