C18H23N3O4 — CID 108846490
2-[[(Z)-2-cyano-3-[(3-methoxyphenyl)methylamino]prop-2-enoyl]amino]-4-methylpentanoic acid (PubChem CID 108846490) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-[[(Z)-2-cyano-3-[(3-methoxyphenyl)methylamino]prop-2-enoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[(Z)-2-cyano-3-[(3-methoxyphenyl)methylamino]prop-2-enoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 108846490 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-[[(Z)-2-cyano-3-[(3-methoxyphenyl)methylamino]prop-2-enoyl]amino]-4-methylpentanoic acid |
| SMILES | COc1cccc(CN/C=C(/C#N)C(=O)NC(CC(C)C)C(=O)O)c1 |
| InChI | InChI=1S/C18H23N3O4/c1-12(2)7-16(18(23)24)21-17(22)14(9-19)11-20-10-13-5-4-6-15(8-13)25-3/h4-6,8,11-12,16,20H,7,10H2,1-3H3,(H,21,22)(H,23,24)/b14-11- |
| InChIKey | KWYVIAPAHSAHPS-KAMYIIQDSA-N |
| XLogP | 1.81 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|