C25H31NO6 — CID 10884713
(4R,5S)-3-[(2R,3S,4S)-3-hydroxy-5-[(4-methoxyphenyl)methoxy]-2,4-dimethylpentanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 10884713) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is (4R,5S)-3-[(2R,3S,4S)-3-hydroxy-5-[(4-methoxyphenyl)methoxy]-2,4-dimethylpentanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-3-[(2R,3S,4S)-3-hydroxy-5-[(4-methoxyphenyl)methoxy]-2,4-dimethylpentanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10884713 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | (4R,5S)-3-[(2R,3S,4S)-3-hydroxy-5-[(4-methoxyphenyl)methoxy]-2,4-dimethylpentanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(COC[C@H](C)[C@H](O)[C@@H](C)C(=O)N2C(=O)O[C@@H](c3ccccc3)[C@H]2C)cc1 |
| InChI | InChI=1S/C25H31NO6/c1-16(14-31-15-19-10-12-21(30-4)13-11-19)22(27)17(2)24(28)26-18(3)23(32-25(26)29)20-8-6-5-7-9-20/h5-13,16-18,22-23,27H,14-15H2,1-4H3/t16-,17+,18+,22-,23+/m0/s1 |
| InChIKey | VQTKBJMXYZTWIE-RQKGZFLVSA-N |
| XLogP | 3.95 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |