C22H25N3O4 — CID 108847536
(Z)-2-cyano-3-[2-(4-methoxyphenoxy)ethylamino]-N-[1-(4-methoxyphenyl)ethyl]prop-2-enamide (PubChem CID 108847536) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is (Z)-2-cyano-3-[2-(4-methoxyphenoxy)ethylamino]-N-[1-(4-methoxyphenyl)ethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[2-(4-methoxyphenoxy)ethylamino]-N-[1-(4-methoxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 108847536 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | (Z)-2-cyano-3-[2-(4-methoxyphenoxy)ethylamino]-N-[1-(4-methoxyphenyl)ethyl]prop-2-enamide |
| SMILES | COc1ccc(OCCN/C=C(/C#N)C(=O)NC(C)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H25N3O4/c1-16(17-4-6-19(27-2)7-5-17)25-22(26)18(14-23)15-24-12-13-29-21-10-8-20(28-3)9-11-21/h4-11,15-16,24H,12-13H2,1-3H3,(H,25,26)/b18-15- |
| InChIKey | TZERURCTGXCALE-SDXDJHTJSA-N |
| XLogP | 2.96 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|