C22H26N4O4S — CID 108847796
(Z)-2-cyano-N-[1-(2-ethoxy-5-methylphenyl)ethyl]-3-[(4-sulfamoylphenyl)methylamino]prop-2-enamide (PubChem CID 108847796) has the molecular formula C22H26N4O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is (Z)-2-cyano-N-[1-(2-ethoxy-5-methylphenyl)ethyl]-3-[(4-sulfamoylphenyl)methylamino]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-[1-(2-ethoxy-5-methylphenyl)ethyl]-3-[(4-sulfamoylphenyl)methylamino]prop-2-enamide |
|---|---|
| PubChem CID | 108847796 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | (Z)-2-cyano-N-[1-(2-ethoxy-5-methylphenyl)ethyl]-3-[(4-sulfamoylphenyl)methylamino]prop-2-enamide |
| SMILES | CCOc1ccc(C)cc1C(C)NC(=O)/C(C#N)=C\NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C22H26N4O4S/c1-4-30-21-10-5-15(2)11-20(21)16(3)26-22(27)18(12-23)14-25-13-17-6-8-19(9-7-17)31(24,28)29/h5-11,14,16,25H,4,13H2,1-3H3,(H,26,27)(H2,24,28,29)/b18-14- |
| InChIKey | WMGQOOVCJBWENN-JXAWBTAJSA-N |
| XLogP | 2.42 |
| TPSA | 134.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|