C24H24Cl2O2S — CID 10884804
(1Z)-1-chloro-1-[4-[4-[(1Z)-1-chloro-3-hydroxyhexa-1,5-dienyl]phenyl]sulfanylphenyl]hexa-1,5-dien-3-ol (PubChem CID 10884804) has the molecular formula C24H24Cl2O2S and a molecular weight of 447.43 g/mol. Its IUPAC name is (1Z)-1-chloro-1-[4-[4-[(1Z)-1-chloro-3-hydroxyhexa-1,5-dienyl]phenyl]sulfanylphenyl]hexa-1,5-dien-3-ol.
| Compound Name | (1Z)-1-chloro-1-[4-[4-[(1Z)-1-chloro-3-hydroxyhexa-1,5-dienyl]phenyl]sulfanylphenyl]hexa-1,5-dien-3-ol |
|---|---|
| PubChem CID | 10884804 |
| Molecular Formula | C24H24Cl2O2S |
| Molecular Weight | 447.43 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | (1Z)-1-chloro-1-[4-[4-[(1Z)-1-chloro-3-hydroxyhexa-1,5-dienyl]phenyl]sulfanylphenyl]hexa-1,5-dien-3-ol |
| SMILES | C=CCC(O)/C=C(\Cl)c1ccc(Sc2ccc(/C(Cl)=C/C(O)CC=C)cc2)cc1 |
| InChI | InChI=1S/C24H24Cl2O2S/c1-3-5-19(27)15-23(25)17-7-11-21(12-8-17)29-22-13-9-18(10-14-22)24(26)16-20(28)6-4-2/h3-4,7-16,19-20,27-28H,1-2,5-6H2/b23-15-,24-16- |
| InChIKey | ZWPRKLIOBBZEPI-MPKYGIEOSA-N |
| XLogP | 6.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.43 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|