C26H46O4Si — CID 10884868
(4'R,4'aR,8'aS)-3',4',8'a-trimethyl-4'-[2-tri(propan-2-yl)silyloxyethyl]spiro[1,3-dioxolane-2,8'-4a,5,6,7-tetrahydronaphthalene]-1'-one (PubChem CID 10884868) has the molecular formula C26H46O4Si and a molecular weight of 450.74 g/mol. Its IUPAC name is (4'R,4'aR,8'aS)-3',4',8'a-trimethyl-4'-[2-tri(propan-2-yl)silyloxyethyl]spiro[1,3-dioxolane-2,8'-4a,5,6,7-tetrahydronaphthalene]-1'-one.
| Compound Name | (4'R,4'aR,8'aS)-3',4',8'a-trimethyl-4'-[2-tri(propan-2-yl)silyloxyethyl]spiro[1,3-dioxolane-2,8'-4a,5,6,7-tetrahydronaphthalene]-1'-one |
|---|---|
| PubChem CID | 10884868 |
| Molecular Formula | C26H46O4Si |
| Molecular Weight | 450.74 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | (4'R,4'aR,8'aS)-3',4',8'a-trimethyl-4'-[2-tri(propan-2-yl)silyloxyethyl]spiro[1,3-dioxolane-2,8'-4a,5,6,7-tetrahydronaphthalene]-1'-one |
| SMILES | CC1=CC(=O)[C@]2(C)[C@H](CCCC23OCCO3)[C@@]1(C)CCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H46O4Si/c1-18(2)31(19(3)4,20(5)6)30-14-13-24(8)21(7)17-23(27)25(9)22(24)11-10-12-26(25)28-15-16-29-26/h17-20,22H,10-16H2,1-9H3/t22-,24+,25+/m1/s1 |
| InChIKey | QDZLKAZGSRGNNS-VJTSUQJLSA-N |
| XLogP | 6.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.74 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|