C21H23N3O2 — CID 108849176
(Z)-2-cyano-N-(2,6-diethylphenyl)-3-(4-methoxyanilino)prop-2-enamide (PubChem CID 108849176) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,6-diethylphenyl)-3-(4-methoxyanilino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,6-diethylphenyl)-3-(4-methoxyanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108849176 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (Z)-2-cyano-N-(2,6-diethylphenyl)-3-(4-methoxyanilino)prop-2-enamide |
| SMILES | CCc1cccc(CC)c1NC(=O)/C(C#N)=C\Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H23N3O2/c1-4-15-7-6-8-16(5-2)20(15)24-21(25)17(13-22)14-23-18-9-11-19(26-3)12-10-18/h6-12,14,23H,4-5H2,1-3H3,(H,24,25)/b17-14- |
| InChIKey | LGYVJISXFNCLQJ-VKAVYKQESA-N |
| XLogP | 4.28 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|