C22H23N3O3 — CID 108849303
4-[[[(Z)-2-cyano-3-(2,6-diethylanilino)-3-oxoprop-1-enyl]amino]methyl]benzoic acid (PubChem CID 108849303) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 4-[[[(Z)-2-cyano-3-(2,6-diethylanilino)-3-oxoprop-1-enyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[(Z)-2-cyano-3-(2,6-diethylanilino)-3-oxoprop-1-enyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 108849303 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 4-[[[(Z)-2-cyano-3-(2,6-diethylanilino)-3-oxoprop-1-enyl]amino]methyl]benzoic acid |
| SMILES | CCc1cccc(CC)c1NC(=O)/C(C#N)=C\NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H23N3O3/c1-3-16-6-5-7-17(4-2)20(16)25-21(26)19(12-23)14-24-13-15-8-10-18(11-9-15)22(27)28/h5-11,14,24H,3-4,13H2,1-2H3,(H,25,26)(H,27,28)/b19-14- |
| InChIKey | OXBUKUBUPLPEQN-RGEXLXHISA-N |
| XLogP | 3.65 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|