C22H24FN3O — CID 108849486
(Z)-2-cyano-N-(2,6-diethylphenyl)-3-[2-(3-fluorophenyl)ethylamino]prop-2-enamide (PubChem CID 108849486) has the molecular formula C22H24FN3O and a molecular weight of 365.45 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,6-diethylphenyl)-3-[2-(3-fluorophenyl)ethylamino]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,6-diethylphenyl)-3-[2-(3-fluorophenyl)ethylamino]prop-2-enamide |
|---|---|
| PubChem CID | 108849486 |
| Molecular Formula | C22H24FN3O |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | (Z)-2-cyano-N-(2,6-diethylphenyl)-3-[2-(3-fluorophenyl)ethylamino]prop-2-enamide |
| SMILES | CCc1cccc(CC)c1NC(=O)/C(C#N)=C\NCCc1cccc(F)c1 |
| InChI | InChI=1S/C22H24FN3O/c1-3-17-8-6-9-18(4-2)21(17)26-22(27)19(14-24)15-25-12-11-16-7-5-10-20(23)13-16/h5-10,13,15,25H,3-4,11-12H2,1-2H3,(H,26,27)/b19-15- |
| InChIKey | SKDRNCFRDOSYIC-CYVLTUHYSA-N |
| XLogP | 4.13 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|