C25H40O4Si2 — CID 10885031
(5Z)-5-[(2S,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-phenylpropylidene]furan-2-one (PubChem CID 10885031) has the molecular formula C25H40O4Si2 and a molecular weight of 460.76 g/mol. Its IUPAC name is (5Z)-5-[(2S,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-phenylpropylidene]furan-2-one.
| Compound Name | (5Z)-5-[(2S,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-phenylpropylidene]furan-2-one |
|---|---|
| PubChem CID | 10885031 |
| Molecular Formula | C25H40O4Si2 |
| Molecular Weight | 460.76 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | (5Z)-5-[(2S,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-phenylpropylidene]furan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](/C=C1/C=CC(=O)O1)[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C25H40O4Si2/c1-24(2,3)30(7,8)28-21(18-20-16-17-22(26)27-20)23(19-14-12-11-13-15-19)29-31(9,10)25(4,5)6/h11-18,21,23H,1-10H3/b20-18-/t21-,23+/m0/s1 |
| InChIKey | UVBCDBIMFTXAQB-AUWWGTENSA-N |
| XLogP | 7.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.76 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|