C23H44N4O6 — CID 10885210
tritert-butyl 1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate (PubChem CID 10885210) has the molecular formula C23H44N4O6 and a molecular weight of 472.63 g/mol. Its IUPAC name is tritert-butyl 1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate.
| Compound Name | tritert-butyl 1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
|---|---|
| PubChem CID | 10885210 |
| Molecular Formula | C23H44N4O6 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.33 |
| IUPAC Name | tritert-butyl 1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNCCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H44N4O6/c1-21(2,3)31-18(28)25-12-10-24-11-13-26(19(29)32-22(4,5)6)15-17-27(16-14-25)20(30)33-23(7,8)9/h24H,10-17H2,1-9H3 |
| InChIKey | ZXASHTYJQJMCQR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|