C15H17FN4O3S — CID 108852104
(Z)-2-cyano-N-(4-fluorophenyl)-3-(4-methylsulfonylpiperazin-1-yl)prop-2-enamide (PubChem CID 108852104) has the molecular formula C15H17FN4O3S and a molecular weight of 352.39 g/mol. Its IUPAC name is (Z)-2-cyano-N-(4-fluorophenyl)-3-(4-methylsulfonylpiperazin-1-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(4-fluorophenyl)-3-(4-methylsulfonylpiperazin-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108852104 |
| Molecular Formula | C15H17FN4O3S |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | (Z)-2-cyano-N-(4-fluorophenyl)-3-(4-methylsulfonylpiperazin-1-yl)prop-2-enamide |
| SMILES | CS(=O)(=O)N1CCN(/C=C(/C#N)C(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C15H17FN4O3S/c1-24(22,23)20-8-6-19(7-9-20)11-12(10-17)15(21)18-14-4-2-13(16)3-5-14/h2-5,11H,6-9H2,1H3,(H,18,21)/b12-11- |
| InChIKey | PYKAEKMUDRYPHP-QXMHVHEDSA-N |
| XLogP | 0.75 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|