C24H35NO7Si — CID 10885280
methyl (1R,2R,6R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(phenylmethoxycarbonylamino)-2-trimethylsilyloxycyclohex-3-ene-1-carboxylate (PubChem CID 10885280) has the molecular formula C24H35NO7Si and a molecular weight of 477.63 g/mol. Its IUPAC name is methyl (1R,2R,6R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(phenylmethoxycarbonylamino)-2-trimethylsilyloxycyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R,2R,6R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(phenylmethoxycarbonylamino)-2-trimethylsilyloxycyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 10885280 |
| Molecular Formula | C24H35NO7Si |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | methyl (1R,2R,6R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(phenylmethoxycarbonylamino)-2-trimethylsilyloxycyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@]1(NC(=O)OCc2ccccc2)[C@H](O[Si](C)(C)C)C=CC[C@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C24H35NO7Si/c1-23(2)30-16-19(31-23)18-13-10-14-20(32-33(4,5)6)24(18,21(26)28-3)25-22(27)29-15-17-11-8-7-9-12-17/h7-12,14,18-20H,13,15-16H2,1-6H3,(H,25,27)/t18-,19+,20+,24+/m0/s1 |
| InChIKey | GBQXQPZEWQWOBW-UECWXEIQSA-N |
| XLogP | 3.77 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|