C28H21NO7 — CID 10885351
17-hydroxy-12-(4-hydroxy-3-methoxyphenyl)-8,16-dimethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5(10),6,8,12,14,16,18,20-nonaen-3-one (PubChem CID 10885351) has the molecular formula C28H21NO7 and a molecular weight of 483.48 g/mol. Its IUPAC name is 17-hydroxy-12-(4-hydroxy-3-methoxyphenyl)-8,16-dimethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5(10),6,8,12,14,16,18,20-nonaen-3-one.
| Compound Name | 17-hydroxy-12-(4-hydroxy-3-methoxyphenyl)-8,16-dimethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5(10),6,8,12,14,16,18,20-nonaen-3-one |
|---|---|
| PubChem CID | 10885351 |
| Molecular Formula | C28H21NO7 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 17-hydroxy-12-(4-hydroxy-3-methoxyphenyl)-8,16-dimethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5(10),6,8,12,14,16,18,20-nonaen-3-one |
| SMILES | COc1ccc2oc(=O)c3c(c(-c4ccc(O)c(OC)c4)c4c5cc(OC)c(O)cc5ccn43)c2c1 |
| InChI | InChI=1S/C28H21NO7/c1-33-16-5-7-21-18(12-16)25-24(15-4-6-19(30)22(11-15)34-2)26-17-13-23(35-3)20(31)10-14(17)8-9-29(26)27(25)28(32)36-21/h4-13,30-31H,1-3H3 |
| InChIKey | BAHMPEUXEKDLLN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|