C18H15ClN4O4 — CID 108853876
(Z)-N-(2-chloro-5-nitrophenyl)-2-cyano-3-[(2-methoxyphenyl)methylamino]prop-2-enamide (PubChem CID 108853876) has the molecular formula C18H15ClN4O4 and a molecular weight of 386.80 g/mol. Its IUPAC name is (Z)-N-(2-chloro-5-nitrophenyl)-2-cyano-3-[(2-methoxyphenyl)methylamino]prop-2-enamide.
| Compound Name | (Z)-N-(2-chloro-5-nitrophenyl)-2-cyano-3-[(2-methoxyphenyl)methylamino]prop-2-enamide |
|---|---|
| PubChem CID | 108853876 |
| Molecular Formula | C18H15ClN4O4 |
| Molecular Weight | 386.80 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | (Z)-N-(2-chloro-5-nitrophenyl)-2-cyano-3-[(2-methoxyphenyl)methylamino]prop-2-enamide |
| SMILES | COc1ccccc1CN/C=C(/C#N)C(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C18H15ClN4O4/c1-27-17-5-3-2-4-12(17)10-21-11-13(9-20)18(24)22-16-8-14(23(25)26)6-7-15(16)19/h2-8,11,21H,10H2,1H3,(H,22,24)/b13-11- |
| InChIKey | XFVDOFIMUIHNIQ-QBFSEMIESA-N |
| XLogP | 3.39 |
| TPSA | 117.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.80 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|