C22H39N5O7 — CID 10885391
(8S,11R,12S)-12-N-hydroxy-8-N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]-11-(2-methylpropyl)-2,10-dioxo-1-oxa-3,9-diazacyclopentadecane-8,12-dicarboxamide (PubChem CID 10885391) has the molecular formula C22H39N5O7 and a molecular weight of 485.58 g/mol. Its IUPAC name is (8S,11R,12S)-12-N-hydroxy-8-N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]-11-(2-methylpropyl)-2,10-dioxo-1-oxa-3,9-diazacyclopentadecane-8,12-dicarboxamide.
| Compound Name | (8S,11R,12S)-12-N-hydroxy-8-N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]-11-(2-methylpropyl)-2,10-dioxo-1-oxa-3,9-diazacyclopentadecane-8,12-dicarboxamide |
|---|---|
| PubChem CID | 10885391 |
| Molecular Formula | C22H39N5O7 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | (8S,11R,12S)-12-N-hydroxy-8-N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]-11-(2-methylpropyl)-2,10-dioxo-1-oxa-3,9-diazacyclopentadecane-8,12-dicarboxamide |
| SMILES | CNC(=O)[C@H](C)NC(=O)[C@@H]1CCCCNC(=O)OCCC[C@H](C(=O)NO)[C@@H](CC(C)C)C(=O)N1 |
| InChI | InChI=1S/C22H39N5O7/c1-13(2)12-16-15(20(30)27-33)8-7-11-34-22(32)24-10-6-5-9-17(26-19(16)29)21(31)25-14(3)18(28)23-4/h13-17,33H,5-12H2,1-4H3,(H,23,28)(H,24,32)(H,25,31)(H,26,29)(H,27,30)/t14-,15-,16+,17-/m0/s1 |
| InChIKey | OSOBOMGYNPIPHU-NXOAAHMSSA-N |
| XLogP | 0.20 |
| TPSA | 174.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|