C19H32ClN3O — CID 108854107
(Z)-N-(3-chloropropyl)-2-cyano-3-(cyclododecylamino)prop-2-enamide (PubChem CID 108854107) has the molecular formula C19H32ClN3O and a molecular weight of 353.94 g/mol. Its IUPAC name is (Z)-N-(3-chloropropyl)-2-cyano-3-(cyclododecylamino)prop-2-enamide.
| Compound Name | (Z)-N-(3-chloropropyl)-2-cyano-3-(cyclododecylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108854107 |
| Molecular Formula | C19H32ClN3O |
| Molecular Weight | 353.94 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | (Z)-N-(3-chloropropyl)-2-cyano-3-(cyclododecylamino)prop-2-enamide |
| SMILES | N#C/C(=C/NC1CCCCCCCCCCC1)C(=O)NCCCCl |
| InChI | InChI=1S/C19H32ClN3O/c20-13-10-14-22-19(24)17(15-21)16-23-18-11-8-6-4-2-1-3-5-7-9-12-18/h16,18,23H,1-14H2,(H,22,24)/b17-16- |
| InChIKey | OSPCYSUPZLMKCP-MSUUIHNZSA-N |
| XLogP | 4.40 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.94 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|