C29H36O5Si — CID 10885503
5-[3-[tert-butyl(diphenyl)silyl]oxyhepta-5,6-dienyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 10885503) has the molecular formula C29H36O5Si and a molecular weight of 492.69 g/mol. Its IUPAC name is 5-[3-[tert-butyl(diphenyl)silyl]oxyhepta-5,6-dienyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[3-[tert-butyl(diphenyl)silyl]oxyhepta-5,6-dienyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 10885503 |
| Molecular Formula | C29H36O5Si |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 5-[3-[tert-butyl(diphenyl)silyl]oxyhepta-5,6-dienyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | C=C=CCC(CCC1C(=O)OC(C)(C)OC1=O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H36O5Si/c1-7-8-15-22(20-21-25-26(30)32-29(5,6)33-27(25)31)34-35(28(2,3)4,23-16-11-9-12-17-23)24-18-13-10-14-19-24/h8-14,16-19,22,25H,1,15,20-21H2,2-6H3 |
| InChIKey | OYVCKWUCKJEOBV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|