C27H44O6Si — CID 10885507
(2R)-2-[(2R,3S,4E,6E,9S,10S,11R,12E,14E)-3,15-dimethoxy-7,9,11,13-tetramethyl-16-oxo-10-trimethylsilyloxy-1-oxacyclohexadeca-4,6,12,14-tetraen-2-yl]propanal (PubChem CID 10885507) has the molecular formula C27H44O6Si and a molecular weight of 492.73 g/mol. Its IUPAC name is (2R)-2-[(2R,3S,4E,6E,9S,10S,11R,12E,14E)-3,15-dimethoxy-7,9,11,13-tetramethyl-16-oxo-10-trimethylsilyloxy-1-oxacyclohexadeca-4,6,12,14-tetraen-2-yl]propanal.
| Compound Name | (2R)-2-[(2R,3S,4E,6E,9S,10S,11R,12E,14E)-3,15-dimethoxy-7,9,11,13-tetramethyl-16-oxo-10-trimethylsilyloxy-1-oxacyclohexadeca-4,6,12,14-tetraen-2-yl]propanal |
|---|---|
| PubChem CID | 10885507 |
| Molecular Formula | C27H44O6Si |
| Molecular Weight | 492.73 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | (2R)-2-[(2R,3S,4E,6E,9S,10S,11R,12E,14E)-3,15-dimethoxy-7,9,11,13-tetramethyl-16-oxo-10-trimethylsilyloxy-1-oxacyclohexadeca-4,6,12,14-tetraen-2-yl]propanal |
| SMILES | CO/C1=C/C(C)=C/[C@@H](C)[C@@H](O[Si](C)(C)C)[C@@H](C)C/C(C)=C/C=C/[C@H](OC)[C@@H]([C@@H](C)C=O)OC1=O |
| InChI | InChI=1S/C27H44O6Si/c1-18-12-11-13-23(30-6)26(22(5)17-28)32-27(29)24(31-7)16-19(2)15-21(4)25(20(3)14-18)33-34(8,9)10/h11-13,15-17,20-23,25-26H,14H2,1-10H3/b13-11+,18-12+,19-15+,24-16+/t20-,21+,22-,23-,25-,26+/m0/s1 |
| InChIKey | WWPBFLADJBJRMT-LRHGHDCFSA-N |
| XLogP | 5.62 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.73 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|