C26H46O7Si — CID 10885576
ethyl 8-[(1R,2S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-(3-ethoxy-3-oxopropyl)-3-oxocyclopentyl]-6-oxooctanoate (PubChem CID 10885576) has the molecular formula C26H46O7Si and a molecular weight of 498.73 g/mol. Its IUPAC name is ethyl 8-[(1R,2S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-(3-ethoxy-3-oxopropyl)-3-oxocyclopentyl]-6-oxooctanoate.
| Compound Name | ethyl 8-[(1R,2S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-(3-ethoxy-3-oxopropyl)-3-oxocyclopentyl]-6-oxooctanoate |
|---|---|
| PubChem CID | 10885576 |
| Molecular Formula | C26H46O7Si |
| Molecular Weight | 498.73 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | ethyl 8-[(1R,2S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-(3-ethoxy-3-oxopropyl)-3-oxocyclopentyl]-6-oxooctanoate |
| SMILES | CCOC(=O)CCCCC(=O)CC[C@@H]1[C@H](CCC(=O)OCC)C(=O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H46O7Si/c1-8-31-24(29)13-11-10-12-19(27)14-15-21-20(16-17-25(30)32-9-2)22(28)18-23(21)33-34(6,7)26(3,4)5/h20-21,23H,8-18H2,1-7H3/t20-,21+,23+/m0/s1 |
| InChIKey | OPKBRZXKYLLTFV-QZNHQXDQSA-N |
| XLogP | 5.40 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.73 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|