C20H26N4O5 — CID 108856211
butyl 2-[[(Z)-3-[2-aminoethyl(ethoxycarbonyl)amino]-2-cyanoprop-2-enoyl]amino]benzoate (PubChem CID 108856211) has the molecular formula C20H26N4O5 and a molecular weight of 402.45 g/mol. Its IUPAC name is butyl 2-[[(Z)-3-[2-aminoethyl(ethoxycarbonyl)amino]-2-cyanoprop-2-enoyl]amino]benzoate.
| Compound Name | butyl 2-[[(Z)-3-[2-aminoethyl(ethoxycarbonyl)amino]-2-cyanoprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 108856211 |
| Molecular Formula | C20H26N4O5 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | butyl 2-[[(Z)-3-[2-aminoethyl(ethoxycarbonyl)amino]-2-cyanoprop-2-enoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)/C(C#N)=C\N(CCN)C(=O)OCC |
| InChI | InChI=1S/C20H26N4O5/c1-3-5-12-29-19(26)16-8-6-7-9-17(16)23-18(25)15(13-22)14-24(11-10-21)20(27)28-4-2/h6-9,14H,3-5,10-12,21H2,1-2H3,(H,23,25)/b15-14- |
| InChIKey | WRFWKIICAPUHDX-PFONDFGASA-N |
| XLogP | 2.41 |
| TPSA | 134.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|