About 2-(4-cyanophenyl)ethyl 4-[4,4-bis(4-fluorophenyl)butyl]piperazine-1-carboxylate
2-(4-cyanophenyl)ethyl 4-[4,4-bis(4-fluorophenyl)butyl]piperazine-1-carboxylate (PubChem CID 10885636) has the molecular formula C30H31F2N3O2
and a molecular weight of 503.59 g/mol. Its IUPAC name is 2-(4-cyanophenyl)ethyl 4-[4,4-bis(4-fluorophenyl)butyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | 2-(4-cyanophenyl)ethyl 4-[4,4-bis(4-fluorophenyl)butyl]piperazine-1-carboxylate |
| PubChem CID | 10885636 |
| Molecular Formula | C30H31F2N3O2 |
| Molecular Weight | 503.59 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 2-(4-cyanophenyl)ethyl 4-[4,4-bis(4-fluorophenyl)butyl]piperazine-1-carboxylate |
| SMILES | N#Cc1ccc(CCOC(=O)N2CCN(CCCC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C30H31F2N3O2/c31-27-11-7-25(8-12-27)29(26-9-13-28(32)14-10-26)2-1-16-34-17-19-35(20-18-34)30(36)37-21-15-23-3-5-24(22-33)6-4-23/h3-14,29H,1-2,15-21H2 |
| InChIKey | JJKPSOUEWPDPFS-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.59 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-cyanophenyl)ethyl 4-[4,4-bis(4-fluorophenyl)butyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-cyanophenyl)ethyl 4-[4,4-bis(4-fluorophenyl)butyl]piperazine-1-carboxylate?
The IUPAC name of 2-(4-cyanophenyl)ethyl 4-[4,4-bis(4-fluorophenyl)butyl]piperazine-1-carboxylate (CID 10885636) is 2-(4-cyanophenyl)ethyl 4-[4,4-bis(4-fluorophenyl)butyl]piperazine-1-carboxylate.
What is the SMILES notation for 2-(4-cyanophenyl)ethyl 4-[4,4-bis(4-fluorophenyl)butyl]piperazine-1-carboxylate?
The canonical SMILES for 2-(4-cyanophenyl)ethyl 4-[4,4-bis(4-fluorophenyl)butyl]piperazine-1-carboxylate is N#Cc1ccc(CCOC(=O)N2CCN(CCCC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc1.
What is the InChIKey of 2-(4-cyanophenyl)ethyl 4-[4,4-bis(4-fluorophenyl)butyl]piperazine-1-carboxylate?
The InChIKey is JJKPSOUEWPDPFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H31F2N3O2/c31-27-11-7-25(8-12-27)29(26-9-13-28(32)14-10-26)2-1-16-34-17-19-35(20-18-34)30(36)37-21-15-23-3-5-24(22-33)6-4-23/h3-14,29H,1-2,15-21H2.
What are the key properties of 2-(4-cyanophenyl)ethyl 4-[4,4-bis(4-fluorophenyl)butyl]piperazine-1-carboxylate?
2-(4-cyanophenyl)ethyl 4-[4,4-bis(4-fluorophenyl)butyl]piperazine-1-carboxylate has a molecular weight of 503.59 g/mol, XLogP of 5.75, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-cyanophenyl)ethyl 4-[4,4-bis(4-fluorophenyl)butyl]piperazine-1-carboxylate is sourced from PubChem (CID 10885636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).