C16H20N4O2 — CID 108857562
(Z)-3-[3-aminopropyl(formyl)amino]-2-cyano-N-(2,3-dimethylphenyl)prop-2-enamide (PubChem CID 108857562) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is (Z)-3-[3-aminopropyl(formyl)amino]-2-cyano-N-(2,3-dimethylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[3-aminopropyl(formyl)amino]-2-cyano-N-(2,3-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108857562 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (Z)-3-[3-aminopropyl(formyl)amino]-2-cyano-N-(2,3-dimethylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(NC(=O)/C(C#N)=C\N(C=O)CCCN)c1C |
| InChI | InChI=1S/C16H20N4O2/c1-12-5-3-6-15(13(12)2)19-16(22)14(9-18)10-20(11-21)8-4-7-17/h3,5-6,10-11H,4,7-8,17H2,1-2H3,(H,19,22)/b14-10- |
| InChIKey | UOAPEPMKDKLBSL-UVTDQMKNSA-N |
| XLogP | 1.46 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|