C18H21N3O — CID 108857833
(Z)-3-[bis(prop-2-enyl)amino]-2-cyano-N-(2,4-dimethylphenyl)prop-2-enamide (PubChem CID 108857833) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is (Z)-3-[bis(prop-2-enyl)amino]-2-cyano-N-(2,4-dimethylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[bis(prop-2-enyl)amino]-2-cyano-N-(2,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108857833 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | (Z)-3-[bis(prop-2-enyl)amino]-2-cyano-N-(2,4-dimethylphenyl)prop-2-enamide |
| SMILES | C=CCN(/C=C(/C#N)C(=O)Nc1ccc(C)cc1C)CC=C |
| InChI | InChI=1S/C18H21N3O/c1-5-9-21(10-6-2)13-16(12-19)18(22)20-17-8-7-14(3)11-15(17)4/h5-8,11,13H,1-2,9-10H2,3-4H3,(H,20,22)/b16-13- |
| InChIKey | AXQBQIZNTLCQKN-SSZFMOIBSA-N |
| XLogP | 3.32 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|