C13H10F3I2N3 — CID 10885816
4,6-diiodo-N-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]pyrimidin-5-amine (PubChem CID 10885816) has the molecular formula C13H10F3I2N3 and a molecular weight of 519.05 g/mol. Its IUPAC name is 4,6-diiodo-N-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]pyrimidin-5-amine.
| Compound Name | 4,6-diiodo-N-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]pyrimidin-5-amine |
|---|---|
| PubChem CID | 10885816 |
| Molecular Formula | C13H10F3I2N3 |
| Molecular Weight | 519.05 g/mol |
| Exact Mass | 518.89 |
| IUPAC Name | 4,6-diiodo-N-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]pyrimidin-5-amine |
| SMILES | CN(Cc1ccccc1C(F)(F)F)c1c(I)ncnc1I |
| InChI | InChI=1S/C13H10F3I2N3/c1-21(10-11(17)19-7-20-12(10)18)6-8-4-2-3-5-9(8)13(14,15)16/h2-5,7H,6H2,1H3 |
| InChIKey | MECWSQPNQNNFIL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.05 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|