C25H45F3O4SSi — CID 10885902
[(4aS,5R,6R,8aS)-5,6,8a-trimethyl-5-[2-tri(propan-2-yl)silyloxyethyl]-3,4,4a,6,7,8-hexahydronaphthalen-1-yl] trifluoromethanesulfonate (PubChem CID 10885902) has the molecular formula C25H45F3O4SSi and a molecular weight of 526.78 g/mol. Its IUPAC name is [(4aS,5R,6R,8aS)-5,6,8a-trimethyl-5-[2-tri(propan-2-yl)silyloxyethyl]-3,4,4a,6,7,8-hexahydronaphthalen-1-yl] trifluoromethanesulfonate.
| Compound Name | [(4aS,5R,6R,8aS)-5,6,8a-trimethyl-5-[2-tri(propan-2-yl)silyloxyethyl]-3,4,4a,6,7,8-hexahydronaphthalen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10885902 |
| Molecular Formula | C25H45F3O4SSi |
| Molecular Weight | 526.78 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | [(4aS,5R,6R,8aS)-5,6,8a-trimethyl-5-[2-tri(propan-2-yl)silyloxyethyl]-3,4,4a,6,7,8-hexahydronaphthalen-1-yl] trifluoromethanesulfonate |
| SMILES | CC(C)[Si](OCC[C@]1(C)[C@H](C)CC[C@]2(C)C(OS(=O)(=O)C(F)(F)F)=CCC[C@@H]12)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H45F3O4SSi/c1-17(2)34(18(3)4,19(5)6)31-16-15-23(8)20(7)13-14-24(9)21(23)11-10-12-22(24)32-33(29,30)25(26,27)28/h12,17-21H,10-11,13-16H2,1-9H3/t20-,21+,23-,24+/m1/s1 |
| InChIKey | LDGZUXOCLWXIHU-JSRBNTPPSA-N |
| XLogP | 8.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.78 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|