C27H39NO6SSi — CID 10885977
tert-butyl-[(2S,3R,4S,5R)-2-methoxy-5-[(2S)-1-(4-methylphenyl)sulfonylaziridin-2-yl]-4-phenylmethoxyoxolan-3-yl]oxy-dimethylsilane (PubChem CID 10885977) has the molecular formula C27H39NO6SSi and a molecular weight of 533.76 g/mol. Its IUPAC name is tert-butyl-[(2S,3R,4S,5R)-2-methoxy-5-[(2S)-1-(4-methylphenyl)sulfonylaziridin-2-yl]-4-phenylmethoxyoxolan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3R,4S,5R)-2-methoxy-5-[(2S)-1-(4-methylphenyl)sulfonylaziridin-2-yl]-4-phenylmethoxyoxolan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10885977 |
| Molecular Formula | C27H39NO6SSi |
| Molecular Weight | 533.76 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | tert-butyl-[(2S,3R,4S,5R)-2-methoxy-5-[(2S)-1-(4-methylphenyl)sulfonylaziridin-2-yl]-4-phenylmethoxyoxolan-3-yl]oxy-dimethylsilane |
| SMILES | CO[C@H]1O[C@H]([C@@H]2CN2S(=O)(=O)c2ccc(C)cc2)[C@H](OCc2ccccc2)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H39NO6SSi/c1-19-13-15-21(16-14-19)35(29,30)28-17-22(28)23-24(32-18-20-11-9-8-10-12-20)25(26(31-5)33-23)34-36(6,7)27(2,3)4/h8-16,22-26H,17-18H2,1-7H3/t22-,23+,24-,25+,26-,28?/m0/s1 |
| InChIKey | GBXSAKGMPJWXFQ-ZSPPAUBFSA-N |
| XLogP | 4.72 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.76 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|