C31H38O4SSi — CID 10885983
methyl (E,5S,6S)-7-(benzenesulfinyl)-5-[tert-butyl(diphenyl)silyl]oxy-6-methylhept-2-enoate (PubChem CID 10885983) has the molecular formula C31H38O4SSi and a molecular weight of 534.79 g/mol. Its IUPAC name is methyl (E,5S,6S)-7-(benzenesulfinyl)-5-[tert-butyl(diphenyl)silyl]oxy-6-methylhept-2-enoate.
| Compound Name | methyl (E,5S,6S)-7-(benzenesulfinyl)-5-[tert-butyl(diphenyl)silyl]oxy-6-methylhept-2-enoate |
|---|---|
| PubChem CID | 10885983 |
| Molecular Formula | C31H38O4SSi |
| Molecular Weight | 534.79 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | methyl (E,5S,6S)-7-(benzenesulfinyl)-5-[tert-butyl(diphenyl)silyl]oxy-6-methylhept-2-enoate |
| SMILES | COC(=O)/C=C/C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](C)CS(=O)c1ccccc1 |
| InChI | InChI=1S/C31H38O4SSi/c1-25(24-36(33)26-16-9-6-10-17-26)29(22-15-23-30(32)34-5)35-37(31(2,3)4,27-18-11-7-12-19-27)28-20-13-8-14-21-28/h6-21,23,25,29H,22,24H2,1-5H3/b23-15+/t25-,29+,36?/m1/s1 |
| InChIKey | WZKFDUHENLIJAE-MPZQMCGQSA-N |
| XLogP | 5.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.79 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|