C17H13Cl2N3O — CID 108860367
(Z)-N-(3-chlorophenyl)-3-[(4-chlorophenyl)methylamino]-2-cyanoprop-2-enamide (PubChem CID 108860367) has the molecular formula C17H13Cl2N3O and a molecular weight of 346.22 g/mol. Its IUPAC name is (Z)-N-(3-chlorophenyl)-3-[(4-chlorophenyl)methylamino]-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-(3-chlorophenyl)-3-[(4-chlorophenyl)methylamino]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108860367 |
| Molecular Formula | C17H13Cl2N3O |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | (Z)-N-(3-chlorophenyl)-3-[(4-chlorophenyl)methylamino]-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/NCc1ccc(Cl)cc1)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H13Cl2N3O/c18-14-6-4-12(5-7-14)10-21-11-13(9-20)17(23)22-16-3-1-2-15(19)8-16/h1-8,11,21H,10H2,(H,22,23)/b13-11- |
| InChIKey | BKXUVKYOPIHSTK-QBFSEMIESA-N |
| XLogP | 4.13 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|