C14H11ClN4O2 — CID 108860462
(Z)-N-(3-chlorophenyl)-2-cyano-3-[(5-methyl-1,2-oxazol-3-yl)amino]prop-2-enamide (PubChem CID 108860462) has the molecular formula C14H11ClN4O2 and a molecular weight of 302.72 g/mol. Its IUPAC name is (Z)-N-(3-chlorophenyl)-2-cyano-3-[(5-methyl-1,2-oxazol-3-yl)amino]prop-2-enamide.
| Compound Name | (Z)-N-(3-chlorophenyl)-2-cyano-3-[(5-methyl-1,2-oxazol-3-yl)amino]prop-2-enamide |
|---|---|
| PubChem CID | 108860462 |
| Molecular Formula | C14H11ClN4O2 |
| Molecular Weight | 302.72 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | (Z)-N-(3-chlorophenyl)-2-cyano-3-[(5-methyl-1,2-oxazol-3-yl)amino]prop-2-enamide |
| SMILES | Cc1cc(N/C=C(/C#N)C(=O)Nc2cccc(Cl)c2)no1 |
| InChI | InChI=1S/C14H11ClN4O2/c1-9-5-13(19-21-9)17-8-10(7-16)14(20)18-12-4-2-3-11(15)6-12/h2-6,8H,1H3,(H,17,19)(H,18,20)/b10-8- |
| InChIKey | KXGCGLCTIZRCEK-NTMALXAHSA-N |
| XLogP | 3.09 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.72 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|