C21H31N5O — CID 108861555
(Z)-2-(4-benzylpiperazine-1-carbonyl)-3-[2-(diethylamino)ethylamino]prop-2-enenitrile (PubChem CID 108861555) has the molecular formula C21H31N5O and a molecular weight of 369.51 g/mol. Its IUPAC name is (Z)-2-(4-benzylpiperazine-1-carbonyl)-3-[2-(diethylamino)ethylamino]prop-2-enenitrile.
| Compound Name | (Z)-2-(4-benzylpiperazine-1-carbonyl)-3-[2-(diethylamino)ethylamino]prop-2-enenitrile |
|---|---|
| PubChem CID | 108861555 |
| Molecular Formula | C21H31N5O |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | (Z)-2-(4-benzylpiperazine-1-carbonyl)-3-[2-(diethylamino)ethylamino]prop-2-enenitrile |
| SMILES | CCN(CC)CCN/C=C(/C#N)C(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H31N5O/c1-3-24(4-2)11-10-23-17-20(16-22)21(27)26-14-12-25(13-15-26)18-19-8-6-5-7-9-19/h5-9,17,23H,3-4,10-15,18H2,1-2H3/b20-17- |
| InChIKey | NCSIDULIVQUVFL-JZJYNLBNSA-N |
| XLogP | 1.67 |
| TPSA | 62.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|