C33H48O7 — CID 10886201
dimethyl 5-[(1R)-1-[(1aR,4aR,7S,7aR,7bR)-1,1,7-trimethyl-4-methylidene-1a,2,3,4a,5,6,7a,7b-octahydrocyclopropa[h]azulen-7-yl]-3-methylbutyl]-2,4,6-trimethoxybenzene-1,3-dicarboxylate (PubChem CID 10886201) has the molecular formula C33H48O7 and a molecular weight of 556.74 g/mol. Its IUPAC name is dimethyl 5-[(1R)-1-[(1aR,4aR,7S,7aR,7bR)-1,1,7-trimethyl-4-methylidene-1a,2,3,4a,5,6,7a,7b-octahydrocyclopropa[h]azulen-7-yl]-3-methylbutyl]-2,4,6-trimethoxybenzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(1R)-1-[(1aR,4aR,7S,7aR,7bR)-1,1,7-trimethyl-4-methylidene-1a,2,3,4a,5,6,7a,7b-octahydrocyclopropa[h]azulen-7-yl]-3-methylbutyl]-2,4,6-trimethoxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 10886201 |
| Molecular Formula | C33H48O7 |
| Molecular Weight | 556.74 g/mol |
| Exact Mass | 556.34 |
| IUPAC Name | dimethyl 5-[(1R)-1-[(1aR,4aR,7S,7aR,7bR)-1,1,7-trimethyl-4-methylidene-1a,2,3,4a,5,6,7a,7b-octahydrocyclopropa[h]azulen-7-yl]-3-methylbutyl]-2,4,6-trimethoxybenzene-1,3-dicarboxylate |
| SMILES | C=C1CC[C@@H]2[C@H]([C@H]3[C@H]1CC[C@]3(C)[C@@H](CC(C)C)c1c(OC)c(C(=O)OC)c(OC)c(C(=O)OC)c1OC)C2(C)C |
| InChI | InChI=1S/C33H48O7/c1-17(2)16-21(33(6)15-14-19-18(3)12-13-20-26(25(19)33)32(20,4)5)22-27(36-7)23(30(34)39-10)29(38-9)24(28(22)37-8)31(35)40-11/h17,19-21,25-26H,3,12-16H2,1-2,4-11H3/t19-,20+,21-,25+,26+,33+/m0/s1 |
| InChIKey | KVDZTLBRQQJJMC-LDDMJQDTSA-N |
| XLogP | 7.07 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.74 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|