C15H25N5O — CID 108863866
(Z)-2-[4-(2-aminoethyl)piperazine-1-carbonyl]-3-piperidin-1-ylprop-2-enenitrile (PubChem CID 108863866) has the molecular formula C15H25N5O and a molecular weight of 291.40 g/mol. Its IUPAC name is (Z)-2-[4-(2-aminoethyl)piperazine-1-carbonyl]-3-piperidin-1-ylprop-2-enenitrile.
| Compound Name | (Z)-2-[4-(2-aminoethyl)piperazine-1-carbonyl]-3-piperidin-1-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 108863866 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | (Z)-2-[4-(2-aminoethyl)piperazine-1-carbonyl]-3-piperidin-1-ylprop-2-enenitrile |
| SMILES | N#C/C(=C/N1CCCCC1)C(=O)N1CCN(CCN)CC1 |
| InChI | InChI=1S/C15H25N5O/c16-4-7-18-8-10-20(11-9-18)15(21)14(12-17)13-19-5-2-1-3-6-19/h13H,1-11,16H2/b14-13- |
| InChIKey | CYWPMQAEBFQRLH-YPKPFQOOSA-N |
| XLogP | -0.02 |
| TPSA | 76.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|