C34H34O4 — CID 10886559
[(2S,3S)-3-[hydroxy(diphenyl)methyl]-1,4-dioxaspiro[4.5]decan-2-yl]-diphenylmethanol (PubChem CID 10886559) has the molecular formula C34H34O4 and a molecular weight of 506.64 g/mol. Its IUPAC name is [(2S,3S)-3-[hydroxy(diphenyl)methyl]-1,4-dioxaspiro[4.5]decan-2-yl]-diphenylmethanol.
| Compound Name | [(2S,3S)-3-[hydroxy(diphenyl)methyl]-1,4-dioxaspiro[4.5]decan-2-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 10886559 |
| Molecular Formula | C34H34O4 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | [(2S,3S)-3-[hydroxy(diphenyl)methyl]-1,4-dioxaspiro[4.5]decan-2-yl]-diphenylmethanol |
| SMILES | OC(c1ccccc1)(c1ccccc1)[C@H]1OC2(CCCCC2)O[C@@H]1C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H34O4/c35-33(26-16-6-1-7-17-26,27-18-8-2-9-19-27)30-31(38-32(37-30)24-14-5-15-25-32)34(36,28-20-10-3-11-21-28)29-22-12-4-13-23-29/h1-4,6-13,16-23,30-31,35-36H,5,14-15,24-25H2/t30-,31-/m0/s1 |
| InChIKey | BFEYEENPZZLVAX-CONSDPRKSA-N |
| XLogP | 6.30 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |