C30H32F3N5O5S — CID 10886723
[4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-methylsulfonylindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;2,2,2-trifluoroacetate (PubChem CID 10886723) has the molecular formula C30H32F3N5O5S and a molecular weight of 631.68 g/mol. Its IUPAC name is [4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-methylsulfonylindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;2,2,2-trifluoroacetate.
| Compound Name | [4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-methylsulfonylindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 10886723 |
| Molecular Formula | C30H32F3N5O5S |
| Molecular Weight | 631.68 g/mol |
| Exact Mass | 631.21 |
| IUPAC Name | [4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-methylsulfonylindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.[H]/N=C(\N)c1cccc(Cn2c(C(=O)NCc3ccc([N+](C)(C)C)cc3)cc3cc(S(C)(=O)=O)ccc32)c1 |
| InChI | InChI=1S/C28H31N5O3S.C2HF3O2/c1-33(2,3)23-10-8-19(9-11-23)17-31-28(34)26-16-22-15-24(37(4,35)36)12-13-25(22)32(26)18-20-6-5-7-21(14-20)27(29)30;3-2(4,5)1(6)7/h5-16H,17-18H2,1-4H3,(H3-,29,30,31,34);(H,6,7) |
| InChIKey | HCHPGWPXZRMUPF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 158.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.68 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|