C46H32N2O2S2 — CID 10887036
2,17-bis(4-methoxyphenyl)-7,12-diphenyl-21,23-dithia-22,24-diazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6(24),7,9,11,13(22),14,16,18-undecaene (PubChem CID 10887036) has the molecular formula C46H32N2O2S2 and a molecular weight of 708.91 g/mol. Its IUPAC name is 2,17-bis(4-methoxyphenyl)-7,12-diphenyl-21,23-dithia-22,24-diazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6(24),7,9,11,13(22),14,16,18-undecaene.
| Compound Name | 2,17-bis(4-methoxyphenyl)-7,12-diphenyl-21,23-dithia-22,24-diazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6(24),7,9,11,13(22),14,16,18-undecaene |
|---|---|
| PubChem CID | 10887036 |
| Molecular Formula | C46H32N2O2S2 |
| Molecular Weight | 708.91 g/mol |
| Exact Mass | 708.19 |
| IUPAC Name | 2,17-bis(4-methoxyphenyl)-7,12-diphenyl-21,23-dithia-22,24-diazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6(24),7,9,11,13(22),14,16,18-undecaene |
| SMILES | COc1ccc(-c2c3nc(c(-c4ccccc4)c4ccc(s4)c(-c4ccccc4)c4nc(c(-c5ccc(OC)cc5)c5ccc2s5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C46H32N2O2S2/c1-49-33-17-13-31(14-18-33)45-37-23-21-35(47-37)43(29-9-5-3-6-10-29)39-25-26-40(51-39)44(30-11-7-4-8-12-30)36-22-24-38(48-36)46(42-28-27-41(45)52-42)32-15-19-34(50-2)20-16-32/h3-28H,1-2H3/b43-35-,43-39-,44-36-,44-40-,45-37-,45-41-,46-38-,46-42- |
| InChIKey | HCRIRIAWDRSRTB-DXYHBFHASA-N |
| XLogP | 12.81 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.91 |
| LogP ≤ 5 | 12.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |