C22H28N2O3 — CID 108870999
1-[1-(4-hydroxyphenoxy)ethyl]-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]urea (PubChem CID 108870999) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-[1-(4-hydroxyphenoxy)ethyl]-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]urea.
| Compound Name | 1-[1-(4-hydroxyphenoxy)ethyl]-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]urea |
|---|---|
| PubChem CID | 108870999 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 1-[1-(4-hydroxyphenoxy)ethyl]-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]urea |
| SMILES | CCC(NC(=O)NC(C)Oc1ccc(O)cc1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C22H28N2O3/c1-3-21(18-9-8-16-6-4-5-7-17(16)14-18)24-22(26)23-15(2)27-20-12-10-19(25)11-13-20/h8-15,21,25H,3-7H2,1-2H3,(H2,23,24,26) |
| InChIKey | YBYQYXNJUOZBCV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|