C17H19ClN2O3 — CID 108871252
1-[2-(2-chlorophenyl)ethyl]-3-[1-(4-hydroxyphenoxy)ethyl]urea (PubChem CID 108871252) has the molecular formula C17H19ClN2O3 and a molecular weight of 334.80 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)ethyl]-3-[1-(4-hydroxyphenoxy)ethyl]urea.
| Compound Name | 1-[2-(2-chlorophenyl)ethyl]-3-[1-(4-hydroxyphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 108871252 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 1-[2-(2-chlorophenyl)ethyl]-3-[1-(4-hydroxyphenoxy)ethyl]urea |
| SMILES | CC(NC(=O)NCCc1ccccc1Cl)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C17H19ClN2O3/c1-12(23-15-8-6-14(21)7-9-15)20-17(22)19-11-10-13-4-2-3-5-16(13)18/h2-9,12,21H,10-11H2,1H3,(H2,19,20,22) |
| InChIKey | PZVRJNKEUCUCRO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|