C15H20N2O4 — CID 108871379
ethyl 1-[(2-hydroxyphenyl)carbamoyl]piperidine-4-carboxylate (PubChem CID 108871379) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is ethyl 1-[(2-hydroxyphenyl)carbamoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(2-hydroxyphenyl)carbamoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 108871379 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | ethyl 1-[(2-hydroxyphenyl)carbamoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)Nc2ccccc2O)CC1 |
| InChI | InChI=1S/C15H20N2O4/c1-2-21-14(19)11-7-9-17(10-8-11)15(20)16-12-5-3-4-6-13(12)18/h3-6,11,18H,2,7-10H2,1H3,(H,16,20) |
| InChIKey | YCEGHLULGOSYFU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|