C16H18N2O4 — CID 108871999
1-[2-(3-methylphenyl)ethyl]-3-(3,4,5-trihydroxyphenyl)urea (PubChem CID 108871999) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 1-[2-(3-methylphenyl)ethyl]-3-(3,4,5-trihydroxyphenyl)urea.
| Compound Name | 1-[2-(3-methylphenyl)ethyl]-3-(3,4,5-trihydroxyphenyl)urea |
|---|---|
| PubChem CID | 108871999 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1-[2-(3-methylphenyl)ethyl]-3-(3,4,5-trihydroxyphenyl)urea |
| SMILES | Cc1cccc(CCNC(=O)Nc2cc(O)c(O)c(O)c2)c1 |
| InChI | InChI=1S/C16H18N2O4/c1-10-3-2-4-11(7-10)5-6-17-16(22)18-12-8-13(19)15(21)14(20)9-12/h2-4,7-9,19-21H,5-6H2,1H3,(H2,17,18,22) |
| InChIKey | YKZIDYDCOSJWDH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|