C20H20FN3O3 — CID 108872736
1-[(3-fluorophenyl)methyl]-3-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]urea (PubChem CID 108872736) has the molecular formula C20H20FN3O3 and a molecular weight of 369.40 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-3-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]urea.
| Compound Name | 1-[(3-fluorophenyl)methyl]-3-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]urea |
|---|---|
| PubChem CID | 108872736 |
| Molecular Formula | C20H20FN3O3 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-3-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]urea |
| SMILES | CC(C)CN1C(=O)c2ccc(NC(=O)NCc3cccc(F)c3)cc2C1=O |
| InChI | InChI=1S/C20H20FN3O3/c1-12(2)11-24-18(25)16-7-6-15(9-17(16)19(24)26)23-20(27)22-10-13-4-3-5-14(21)8-13/h3-9,12H,10-11H2,1-2H3,(H2,22,23,27) |
| InChIKey | TYEFQSCLKQCQNS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|