About phenyl(8-phenyliodonioocta-1,7-diynyl)iodanium;bis(trifluoromethanesulfonate)
phenyl(8-phenyliodonioocta-1,7-diynyl)iodanium;bis(trifluoromethanesulfonate) (PubChem CID 10887318) has the molecular formula C22H18F6I2O6S2
and a molecular weight of 810.31 g/mol. Its IUPAC name is phenyl(8-phenyliodonioocta-1,7-diynyl)iodanium;bis(trifluoromethanesulfonate).
Molecular Properties
| Compound Name | phenyl(8-phenyliodonioocta-1,7-diynyl)iodanium;bis(trifluoromethanesulfonate) |
| PubChem CID | 10887318 |
| Molecular Formula | C22H18F6I2O6S2 |
| Molecular Weight | 810.31 g/mol |
| Exact Mass | 809.85 |
| IUPAC Name | phenyl(8-phenyliodonioocta-1,7-diynyl)iodanium;bis(trifluoromethanesulfonate) |
| SMILES | C(#C[I+]c1ccccc1)CCCCC#C[I+]c1ccccc1.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C20H18I2.2CHF3O3S/c1(3-11-17-21-19-13-7-5-8-14-19)2-4-12-18-22-20-15-9-6-10-16-20;2*2-1(3,4)8(5,6)7/h5-10,13-16H,1-4H2;2*(H,5,6,7)/q+2;;/p-2 |
| InChIKey | OLNFUQBNHFHFOP-UHFFFAOYSA-L |
| XLogP | -1.51 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 810.31 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze phenyl(8-phenyliodonioocta-1,7-diynyl)iodanium;bis(trifluoromethanesulfonate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl(8-phenyliodonioocta-1,7-diynyl)iodanium;bis(trifluoromethanesulfonate)?
The IUPAC name of phenyl(8-phenyliodonioocta-1,7-diynyl)iodanium;bis(trifluoromethanesulfonate) (CID 10887318) is phenyl(8-phenyliodonioocta-1,7-diynyl)iodanium;bis(trifluoromethanesulfonate).
What is the SMILES notation for phenyl(8-phenyliodonioocta-1,7-diynyl)iodanium;bis(trifluoromethanesulfonate)?
The canonical SMILES for phenyl(8-phenyliodonioocta-1,7-diynyl)iodanium;bis(trifluoromethanesulfonate) is C(#C[I+]c1ccccc1)CCCCC#C[I+]c1ccccc1.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of phenyl(8-phenyliodonioocta-1,7-diynyl)iodanium;bis(trifluoromethanesulfonate)?
The InChIKey is OLNFUQBNHFHFOP-UHFFFAOYSA-L. The full InChI is InChI=1S/C20H18I2.2CHF3O3S/c1(3-11-17-21-19-13-7-5-8-14-19)2-4-12-18-22-20-15-9-6-10-16-20;2*2-1(3,4)8(5,6)7/h5-10,13-16H,1-4H2;2*(H,5,6,7)/q+2;;/p-2.
What are the key properties of phenyl(8-phenyliodonioocta-1,7-diynyl)iodanium;bis(trifluoromethanesulfonate)?
phenyl(8-phenyliodonioocta-1,7-diynyl)iodanium;bis(trifluoromethanesulfonate) has a molecular weight of 810.31 g/mol, XLogP of -1.51, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl(8-phenyliodonioocta-1,7-diynyl)iodanium;bis(trifluoromethanesulfonate) is sourced from PubChem (CID 10887318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).