C14H6Br8 — CID 10887330
1,2,3,4,5-pentabromo-6-[2-(2,4,6-tribromophenyl)ethyl]benzene (PubChem CID 10887330) has the molecular formula C14H6Br8 and a molecular weight of 813.43 g/mol. Its IUPAC name is 1,2,3,4,5-pentabromo-6-[2-(2,4,6-tribromophenyl)ethyl]benzene.
| Compound Name | 1,2,3,4,5-pentabromo-6-[2-(2,4,6-tribromophenyl)ethyl]benzene |
|---|---|
| PubChem CID | 10887330 |
| Molecular Formula | C14H6Br8 |
| Molecular Weight | 813.43 g/mol |
| Exact Mass | 805.39 |
| IUPAC Name | 1,2,3,4,5-pentabromo-6-[2-(2,4,6-tribromophenyl)ethyl]benzene |
| SMILES | Brc1cc(Br)c(CCc2c(Br)c(Br)c(Br)c(Br)c2Br)c(Br)c1 |
| InChI | InChI=1S/C14H6Br8/c15-5-3-8(16)6(9(17)4-5)1-2-7-10(18)12(20)14(22)13(21)11(7)19/h3-4H,1-2H2 |
| InChIKey | UDMXHULDXNGMGN-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.43 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|