C18H18N2O4 — CID 108874416
3-[[3-(4-methylphenyl)-3-oxopropyl]carbamoylamino]benzoic acid (PubChem CID 108874416) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 3-[[3-(4-methylphenyl)-3-oxopropyl]carbamoylamino]benzoic acid.
| Compound Name | 3-[[3-(4-methylphenyl)-3-oxopropyl]carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 108874416 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 3-[[3-(4-methylphenyl)-3-oxopropyl]carbamoylamino]benzoic acid |
| SMILES | Cc1ccc(C(=O)CCNC(=O)Nc2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C18H18N2O4/c1-12-5-7-13(8-6-12)16(21)9-10-19-18(24)20-15-4-2-3-14(11-15)17(22)23/h2-8,11H,9-10H2,1H3,(H,22,23)(H2,19,20,24) |
| InChIKey | LUIWCJPVNILMLP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |