C15H22N2O4 — CID 108874492
1,1-bis(2-hydroxyethyl)-3-[3-(4-methylphenyl)-3-oxopropyl]urea (PubChem CID 108874492) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 1,1-bis(2-hydroxyethyl)-3-[3-(4-methylphenyl)-3-oxopropyl]urea.
| Compound Name | 1,1-bis(2-hydroxyethyl)-3-[3-(4-methylphenyl)-3-oxopropyl]urea |
|---|---|
| PubChem CID | 108874492 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 1,1-bis(2-hydroxyethyl)-3-[3-(4-methylphenyl)-3-oxopropyl]urea |
| SMILES | Cc1ccc(C(=O)CCNC(=O)N(CCO)CCO)cc1 |
| InChI | InChI=1S/C15H22N2O4/c1-12-2-4-13(5-3-12)14(20)6-7-16-15(21)17(8-10-18)9-11-19/h2-5,18-19H,6-11H2,1H3,(H,16,21) |
| InChIKey | CVWOGPSKTLVHKZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |