C17H26N2O4 — CID 108874774
1-(2,2-diethoxyethyl)-3-[3-(4-methylphenyl)-3-oxopropyl]urea (PubChem CID 108874774) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-3-[3-(4-methylphenyl)-3-oxopropyl]urea.
| Compound Name | 1-(2,2-diethoxyethyl)-3-[3-(4-methylphenyl)-3-oxopropyl]urea |
|---|---|
| PubChem CID | 108874774 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-3-[3-(4-methylphenyl)-3-oxopropyl]urea |
| SMILES | CCOC(CNC(=O)NCCC(=O)c1ccc(C)cc1)OCC |
| InChI | InChI=1S/C17H26N2O4/c1-4-22-16(23-5-2)12-19-17(21)18-11-10-15(20)14-8-6-13(3)7-9-14/h6-9,16H,4-5,10-12H2,1-3H3,(H2,18,19,21) |
| InChIKey | PWZHBSQIEQSENT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|