C14H18ClN3O4 — CID 108875630
methyl 4-[(5-chloro-2-methoxyphenyl)carbamoyl]piperazine-1-carboxylate (PubChem CID 108875630) has the molecular formula C14H18ClN3O4 and a molecular weight of 327.77 g/mol. Its IUPAC name is methyl 4-[(5-chloro-2-methoxyphenyl)carbamoyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[(5-chloro-2-methoxyphenyl)carbamoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108875630 |
| Molecular Formula | C14H18ClN3O4 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | methyl 4-[(5-chloro-2-methoxyphenyl)carbamoyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(C(=O)Nc2cc(Cl)ccc2OC)CC1 |
| InChI | InChI=1S/C14H18ClN3O4/c1-21-12-4-3-10(15)9-11(12)16-13(19)17-5-7-18(8-6-17)14(20)22-2/h3-4,9H,5-8H2,1-2H3,(H,16,19) |
| InChIKey | AZKBQXHQOHNWQN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |